C15H22N2O3 — CID 93452159
N-[(1R,2R)-2-aminocyclohexyl]-2,3-dimethoxybenzamide (PubChem CID 93452159) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 93452159 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)N[C@@H]2CCCC[C@H]2N)c1OC |
| InChI | InChI=1S/C15H22N2O3/c1-19-13-9-5-6-10(14(13)20-2)15(18)17-12-8-4-3-7-11(12)16/h5-6,9,11-12H,3-4,7-8,16H2,1-2H3,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | OECCQBHEDMPLAR-VXGBXAGGSA-N |
| XLogP | 1.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |