C15H24N2O4 — CID 43400025
N-propan-2-yl-2-[(2,3,4-trimethoxyphenyl)methylamino]acetamide (PubChem CID 43400025) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-propan-2-yl-2-[(2,3,4-trimethoxyphenyl)methylamino]acetamide.
| Compound Name | N-propan-2-yl-2-[(2,3,4-trimethoxyphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 43400025 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-propan-2-yl-2-[(2,3,4-trimethoxyphenyl)methylamino]acetamide |
| SMILES | COc1ccc(CNCC(=O)NC(C)C)c(OC)c1OC |
| InChI | InChI=1S/C15H24N2O4/c1-10(2)17-13(18)9-16-8-11-6-7-12(19-3)15(21-5)14(11)20-4/h6-7,10,16H,8-9H2,1-5H3,(H,17,18) |
| InChIKey | MAIBXKOYPGCSKZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |