C12H16Cl2N3S+ — CID 4744709
N-(3,4-dichlorophenyl)-4-methylpiperazin-4-ium-1-carbothioamide (PubChem CID 4744709) has the molecular formula C12H16Cl2N3S+ and a molecular weight of 305.25 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-methylpiperazin-4-ium-1-carbothioamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-methylpiperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 4744709 |
| Molecular Formula | C12H16Cl2N3S+ |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-methylpiperazin-4-ium-1-carbothioamide |
| SMILES | C[NH+]1CCN(C(=S)Nc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H15Cl2N3S/c1-16-4-6-17(7-5-16)12(18)15-9-2-3-10(13)11(14)8-9/h2-3,8H,4-7H2,1H3,(H,15,18)/p+1 |
| InChIKey | MVFCUKAAQGQILZ-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|