C13H18ClFN3OS+ — CID 7325124
N-(3-chloro-4-fluorophenyl)-4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 7325124) has the molecular formula C13H18ClFN3OS+ and a molecular weight of 318.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7325124 |
| Molecular Formula | C13H18ClFN3OS+ |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-(2-hydroxyethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | OCC[NH+]1CCN(C(=S)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17ClFN3OS/c14-11-9-10(1-2-12(11)15)16-13(20)18-5-3-17(4-6-18)7-8-19/h1-2,9,19H,3-8H2,(H,16,20)/p+1 |
| InChIKey | MLIUOZFIMLFLNL-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 39.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|