C16H17ClFN4S+ — CID 9095864
N-(3-chloro-4-fluorophenyl)-4-pyridin-1-ium-4-ylpiperazine-1-carbothioamide (PubChem CID 9095864) has the molecular formula C16H17ClFN4S+ and a molecular weight of 351.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-pyridin-1-ium-4-ylpiperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-pyridin-1-ium-4-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9095864 |
| Molecular Formula | C16H17ClFN4S+ |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-pyridin-1-ium-4-ylpiperazine-1-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CCN(c3cc[nH+]cc3)CC2)cc1Cl |
| InChI | InChI=1S/C16H16ClFN4S/c17-14-11-12(1-2-15(14)18)20-16(23)22-9-7-21(8-10-22)13-3-5-19-6-4-13/h1-6,11H,7-10H2,(H,20,23)/p+1 |
| InChIKey | RSHVERCLGGFWPV-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 32.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|