C18H16Cl2FN3O2S — CID 177332601
2-chloro-4-[[4-(4-chloro-2-fluorophenyl)piperazine-1-carbothioyl]amino]benzoic acid (PubChem CID 177332601) has the molecular formula C18H16Cl2FN3O2S and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-chloro-4-[[4-(4-chloro-2-fluorophenyl)piperazine-1-carbothioyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-(4-chloro-2-fluorophenyl)piperazine-1-carbothioyl]amino]benzoic acid |
|---|---|
| PubChem CID | 177332601 |
| Molecular Formula | C18H16Cl2FN3O2S |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 2-chloro-4-[[4-(4-chloro-2-fluorophenyl)piperazine-1-carbothioyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)N2CCN(c3ccc(Cl)cc3F)CC2)cc1Cl |
| InChI | InChI=1S/C18H16Cl2FN3O2S/c19-11-1-4-16(15(21)9-11)23-5-7-24(8-6-23)18(27)22-12-2-3-13(17(25)26)14(20)10-12/h1-4,9-10H,5-8H2,(H,22,27)(H,25,26) |
| InChIKey | LTKASCXKEOBPSE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|