C19H19ClFN3O4S2 — CID 177332608
2-chloro-4-[[4-(4-fluoro-2-methylsulfonylphenyl)piperazine-1-carbothioyl]amino]benzoic acid (PubChem CID 177332608) has the molecular formula C19H19ClFN3O4S2 and a molecular weight of 471.96 g/mol. Its IUPAC name is 2-chloro-4-[[4-(4-fluoro-2-methylsulfonylphenyl)piperazine-1-carbothioyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-(4-fluoro-2-methylsulfonylphenyl)piperazine-1-carbothioyl]amino]benzoic acid |
|---|---|
| PubChem CID | 177332608 |
| Molecular Formula | C19H19ClFN3O4S2 |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 2-chloro-4-[[4-(4-fluoro-2-methylsulfonylphenyl)piperazine-1-carbothioyl]amino]benzoic acid |
| SMILES | CS(=O)(=O)c1cc(F)ccc1N1CCN(C(=S)Nc2ccc(C(=O)O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H19ClFN3O4S2/c1-30(27,28)17-10-12(21)2-5-16(17)23-6-8-24(9-7-23)19(29)22-13-3-4-14(18(25)26)15(20)11-13/h2-5,10-11H,6-9H2,1H3,(H,22,29)(H,25,26) |
| InChIKey | BNFZFAJGAKJWOT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|