C25H24ClN5O4S — CID 177332693
4-[[4-[3-(benzylamino)-4-nitrophenyl]piperazine-1-carbothioyl]amino]-2-chlorobenzoic acid (PubChem CID 177332693) has the molecular formula C25H24ClN5O4S and a molecular weight of 526.02 g/mol. Its IUPAC name is 4-[[4-[3-(benzylamino)-4-nitrophenyl]piperazine-1-carbothioyl]amino]-2-chlorobenzoic acid.
| Compound Name | 4-[[4-[3-(benzylamino)-4-nitrophenyl]piperazine-1-carbothioyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 177332693 |
| Molecular Formula | C25H24ClN5O4S |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 4-[[4-[3-(benzylamino)-4-nitrophenyl]piperazine-1-carbothioyl]amino]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)N2CCN(c3ccc([N+](=O)[O-])c(NCc4ccccc4)c3)CC2)cc1Cl |
| InChI | InChI=1S/C25H24ClN5O4S/c26-21-14-18(6-8-20(21)24(32)33)28-25(36)30-12-10-29(11-13-30)19-7-9-23(31(34)35)22(15-19)27-16-17-4-2-1-3-5-17/h1-9,14-15,27H,10-13,16H2,(H,28,36)(H,32,33) |
| InChIKey | KHHFSSWANINTLT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|