C21H28N4O2 — CID 11660675
N-benzyl-5-(4-butylpiperazin-1-yl)-2-nitroaniline (PubChem CID 11660675) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-benzyl-5-(4-butylpiperazin-1-yl)-2-nitroaniline.
| Compound Name | N-benzyl-5-(4-butylpiperazin-1-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 11660675 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-benzyl-5-(4-butylpiperazin-1-yl)-2-nitroaniline |
| SMILES | CCCCN1CCN(c2ccc([N+](=O)[O-])c(NCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C21H28N4O2/c1-2-3-11-23-12-14-24(15-13-23)19-9-10-21(25(26)27)20(16-19)22-17-18-7-5-4-6-8-18/h4-10,16,22H,2-3,11-15,17H2,1H3 |
| InChIKey | WHNPCQMONQGNSL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|