C18H23N4O2+ — CID 7069040
N-benzyl-5-[(3R)-3-methylpiperazin-4-ium-1-yl]-2-nitroaniline (PubChem CID 7069040) has the molecular formula C18H23N4O2+ and a molecular weight of 327.41 g/mol. Its IUPAC name is N-benzyl-5-[(3R)-3-methylpiperazin-4-ium-1-yl]-2-nitroaniline.
| Compound Name | N-benzyl-5-[(3R)-3-methylpiperazin-4-ium-1-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 7069040 |
| Molecular Formula | C18H23N4O2+ |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-benzyl-5-[(3R)-3-methylpiperazin-4-ium-1-yl]-2-nitroaniline |
| SMILES | C[C@@H]1CN(c2ccc([N+](=O)[O-])c(NCc3ccccc3)c2)CC[NH2+]1 |
| InChI | InChI=1S/C18H22N4O2/c1-14-13-21(10-9-19-14)16-7-8-18(22(23)24)17(11-16)20-12-15-5-3-2-4-6-15/h2-8,11,14,19-20H,9-10,12-13H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | HSPWJPJXXCYYMW-CQSZACIVSA-O |
| XLogP | 1.98 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|