C19H19ClN4O6S2 — CID 177332776
2-chloro-4-[[4-(3-methylsulfonyl-4-nitrophenyl)piperazine-1-carbothioyl]amino]benzoic acid (PubChem CID 177332776) has the molecular formula C19H19ClN4O6S2 and a molecular weight of 498.97 g/mol. Its IUPAC name is 2-chloro-4-[[4-(3-methylsulfonyl-4-nitrophenyl)piperazine-1-carbothioyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-(3-methylsulfonyl-4-nitrophenyl)piperazine-1-carbothioyl]amino]benzoic acid |
|---|---|
| PubChem CID | 177332776 |
| Molecular Formula | C19H19ClN4O6S2 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 2-chloro-4-[[4-(3-methylsulfonyl-4-nitrophenyl)piperazine-1-carbothioyl]amino]benzoic acid |
| SMILES | CS(=O)(=O)c1cc(N2CCN(C(=S)Nc3ccc(C(=O)O)c(Cl)c3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClN4O6S2/c1-32(29,30)17-11-13(3-5-16(17)24(27)28)22-6-8-23(9-7-22)19(31)21-12-2-4-14(18(25)26)15(20)10-12/h2-5,10-11H,6-9H2,1H3,(H,21,31)(H,25,26) |
| InChIKey | LKEFRJIWGGGYEI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|