C15H23N3O4S — CID 133401780
1-(3-methylsulfonyl-4-nitrophenyl)-4-propyl-1,4-diazepane (PubChem CID 133401780) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-(3-methylsulfonyl-4-nitrophenyl)-4-propyl-1,4-diazepane.
| Compound Name | 1-(3-methylsulfonyl-4-nitrophenyl)-4-propyl-1,4-diazepane |
|---|---|
| PubChem CID | 133401780 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(3-methylsulfonyl-4-nitrophenyl)-4-propyl-1,4-diazepane |
| SMILES | CCCN1CCCN(c2ccc([N+](=O)[O-])c(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C15H23N3O4S/c1-3-7-16-8-4-9-17(11-10-16)13-5-6-14(18(19)20)15(12-13)23(2,21)22/h5-6,12H,3-4,7-11H2,1-2H3 |
| InChIKey | WEAGKGAYLQJLRH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|