C16H20N4O4S2 — CID 133391314
4,5-dimethyl-2-[4-(3-methylsulfonyl-4-nitrophenyl)piperazin-1-yl]-1,3-thiazole (PubChem CID 133391314) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4,5-dimethyl-2-[4-(3-methylsulfonyl-4-nitrophenyl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-[4-(3-methylsulfonyl-4-nitrophenyl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 133391314 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4,5-dimethyl-2-[4-(3-methylsulfonyl-4-nitrophenyl)piperazin-1-yl]-1,3-thiazole |
| SMILES | Cc1nc(N2CCN(c3ccc([N+](=O)[O-])c(S(C)(=O)=O)c3)CC2)sc1C |
| InChI | InChI=1S/C16H20N4O4S2/c1-11-12(2)25-16(17-11)19-8-6-18(7-9-19)13-4-5-14(20(21)22)15(10-13)26(3,23)24/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | CKTDPTNHYQJAEF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|