C17H22N4O5S — CID 133401501
2-[(3,5-dimethylpyrazol-1-yl)methyl]-4-(3-methylsulfonyl-4-nitrophenyl)morpholine (PubChem CID 133401501) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[(3,5-dimethylpyrazol-1-yl)methyl]-4-(3-methylsulfonyl-4-nitrophenyl)morpholine.
| Compound Name | 2-[(3,5-dimethylpyrazol-1-yl)methyl]-4-(3-methylsulfonyl-4-nitrophenyl)morpholine |
|---|---|
| PubChem CID | 133401501 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[(3,5-dimethylpyrazol-1-yl)methyl]-4-(3-methylsulfonyl-4-nitrophenyl)morpholine |
| SMILES | Cc1cc(C)n(CC2CN(c3ccc([N+](=O)[O-])c(S(C)(=O)=O)c3)CCO2)n1 |
| InChI | InChI=1S/C17H22N4O5S/c1-12-8-13(2)20(18-12)11-15-10-19(6-7-26-15)14-4-5-16(21(22)23)17(9-14)27(3,24)25/h4-5,8-9,15H,6-7,10-11H2,1-3H3 |
| InChIKey | HOOLYQUVUIOZJN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|