C16H19FN4O3S — CID 133391156
2-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-4,5-dimethyl-1,3-thiazole (PubChem CID 133391156) has the molecular formula C16H19FN4O3S and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 133391156 |
| Molecular Formula | C16H19FN4O3S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-4,5-dimethyl-1,3-thiazole |
| SMILES | COc1cc(N2CCN(c3nc(C)c(C)s3)CC2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C16H19FN4O3S/c1-10-11(2)25-16(18-10)20-6-4-19(5-7-20)13-9-15(24-3)12(17)8-14(13)21(22)23/h8-9H,4-7H2,1-3H3 |
| InChIKey | BBTVVUFRJFTXKU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|