C16H22FN3O4 — CID 133373587
1-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 133373587) has the molecular formula C16H22FN3O4 and a molecular weight of 339.37 g/mol. Its IUPAC name is 1-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 133373587 |
| Molecular Formula | C16H22FN3O4 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[4-(4-fluoro-5-methoxy-2-nitrophenyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1cc(N2CCN(C(=O)C(C)(C)C)CC2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C16H22FN3O4/c1-16(2,3)15(21)19-7-5-18(6-8-19)12-10-14(24-4)11(17)9-13(12)20(22)23/h9-10H,5-8H2,1-4H3 |
| InChIKey | PNMJNBDCCNBOIR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|