C17H20N4O4S — CID 133391198
methyl 5-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-nitrobenzoate (PubChem CID 133391198) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is methyl 5-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-nitrobenzoate.
| Compound Name | methyl 5-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 133391198 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | methyl 5-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(N2CCN(c3nc(C)c(C)s3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O4S/c1-11-12(2)26-17(18-11)20-8-6-19(7-9-20)13-4-5-15(21(23)24)14(10-13)16(22)25-3/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | DZDSEHBVKCRGIL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|