C19H19ClFN3O4 — CID 25349495
methyl 5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrobenzoate (PubChem CID 25349495) has the molecular formula C19H19ClFN3O4 and a molecular weight of 407.83 g/mol. Its IUPAC name is methyl 5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrobenzoate.
| Compound Name | methyl 5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 25349495 |
| Molecular Formula | C19H19ClFN3O4 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | methyl 5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(N2CCN(Cc3c(F)cccc3Cl)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClFN3O4/c1-28-19(25)14-11-13(5-6-18(14)24(26)27)23-9-7-22(8-10-23)12-15-16(20)3-2-4-17(15)21/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | UTDTVPIBHRGSFC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|