C16H22N2O5 — CID 90291552
methyl 5-[(3S)-3-(methoxymethyl)azepan-1-yl]-2-nitrobenzoate (PubChem CID 90291552) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 5-[(3S)-3-(methoxymethyl)azepan-1-yl]-2-nitrobenzoate.
| Compound Name | methyl 5-[(3S)-3-(methoxymethyl)azepan-1-yl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 90291552 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 5-[(3S)-3-(methoxymethyl)azepan-1-yl]-2-nitrobenzoate |
| SMILES | COC[C@H]1CCCCN(c2ccc([N+](=O)[O-])c(C(=O)OC)c2)C1 |
| InChI | InChI=1S/C16H22N2O5/c1-22-11-12-5-3-4-8-17(10-12)13-6-7-15(18(20)21)14(9-13)16(19)23-2/h6-7,9,12H,3-5,8,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | QQFLJCFOMQQTSN-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|