C17H22N4O4S — CID 133401505
1,3,5-trimethyl-4-[1-(3-methylsulfonyl-4-nitrophenyl)pyrrolidin-2-yl]pyrazole (PubChem CID 133401505) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 1,3,5-trimethyl-4-[1-(3-methylsulfonyl-4-nitrophenyl)pyrrolidin-2-yl]pyrazole.
| Compound Name | 1,3,5-trimethyl-4-[1-(3-methylsulfonyl-4-nitrophenyl)pyrrolidin-2-yl]pyrazole |
|---|---|
| PubChem CID | 133401505 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1,3,5-trimethyl-4-[1-(3-methylsulfonyl-4-nitrophenyl)pyrrolidin-2-yl]pyrazole |
| SMILES | Cc1nn(C)c(C)c1C1CCCN1c1ccc([N+](=O)[O-])c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-11-17(12(2)19(3)18-11)15-6-5-9-20(15)13-7-8-14(21(22)23)16(10-13)26(4,24)25/h7-8,10,15H,5-6,9H2,1-4H3 |
| InChIKey | RKJNDZJKBOTGEO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|