C16H15ClN2O4S — CID 133402192
5-chloro-2-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 133402192) has the molecular formula C16H15ClN2O4S and a molecular weight of 366.83 g/mol. Its IUPAC name is 5-chloro-2-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 5-chloro-2-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 133402192 |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 5-chloro-2-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CS(=O)(=O)c1cc(N2CCc3c(Cl)cccc3C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15ClN2O4S/c1-24(22,23)16-9-12(5-6-15(16)19(20)21)18-8-7-13-11(10-18)3-2-4-14(13)17/h2-6,9H,7-8,10H2,1H3 |
| InChIKey | DOQGUNXDRZJDMR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|