C20H22ClN3O2S — CID 177332577
2-chloro-4-[[4-(1-phenylethyl)piperazine-1-carbothioyl]amino]benzoic acid (PubChem CID 177332577) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 2-chloro-4-[[4-(1-phenylethyl)piperazine-1-carbothioyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-(1-phenylethyl)piperazine-1-carbothioyl]amino]benzoic acid |
|---|---|
| PubChem CID | 177332577 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-chloro-4-[[4-(1-phenylethyl)piperazine-1-carbothioyl]amino]benzoic acid |
| SMILES | CC(c1ccccc1)N1CCN(C(=S)Nc2ccc(C(=O)O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-14(15-5-3-2-4-6-15)23-9-11-24(12-10-23)20(27)22-16-7-8-17(19(25)26)18(21)13-16/h2-8,13-14H,9-12H2,1H3,(H,22,27)(H,25,26) |
| InChIKey | NYFILKZRWNTBLL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|