C19H17ClN4O3S — CID 177332603
2-chloro-4-[[4-(4-cyano-3-hydroxyphenyl)piperazine-1-carbothioyl]amino]benzoic acid (PubChem CID 177332603) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is 2-chloro-4-[[4-(4-cyano-3-hydroxyphenyl)piperazine-1-carbothioyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-(4-cyano-3-hydroxyphenyl)piperazine-1-carbothioyl]amino]benzoic acid |
|---|---|
| PubChem CID | 177332603 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-chloro-4-[[4-(4-cyano-3-hydroxyphenyl)piperazine-1-carbothioyl]amino]benzoic acid |
| SMILES | N#Cc1ccc(N2CCN(C(=S)Nc3ccc(C(=O)O)c(Cl)c3)CC2)cc1O |
| InChI | InChI=1S/C19H17ClN4O3S/c20-16-9-13(2-4-15(16)18(26)27)22-19(28)24-7-5-23(6-8-24)14-3-1-12(11-21)17(25)10-14/h1-4,9-10,25H,5-8H2,(H,22,28)(H,26,27) |
| InChIKey | WYHUAMDNQGSMAD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|