C18H17ClN4S — CID 3586677
N-(3-chlorophenyl)-4-(2-cyanophenyl)piperazine-1-carbothioamide (PubChem CID 3586677) has the molecular formula C18H17ClN4S and a molecular weight of 356.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(2-cyanophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-4-(2-cyanophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3586677 |
| Molecular Formula | C18H17ClN4S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(3-chlorophenyl)-4-(2-cyanophenyl)piperazine-1-carbothioamide |
| SMILES | N#Cc1ccccc1N1CCN(C(=S)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H17ClN4S/c19-15-5-3-6-16(12-15)21-18(24)23-10-8-22(9-11-23)17-7-2-1-4-14(17)13-20/h1-7,12H,8-11H2,(H,21,24) |
| InChIKey | VDSNSORLUVBOKK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|