C20H22N4O2S — CID 3585680
N-(3-cyanophenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide (PubChem CID 3585680) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(3-cyanophenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3585680 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(3-cyanophenyl)-4-(2,4-dimethoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(N2CCN(C(=S)Nc3cccc(C#N)c3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H22N4O2S/c1-25-17-6-7-18(19(13-17)26-2)23-8-10-24(11-9-23)20(27)22-16-5-3-4-15(12-16)14-21/h3-7,12-13H,8-11H2,1-2H3,(H,22,27) |
| InChIKey | WRBVQCCFQKRBCD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|