C20H26N4O3S2 — CID 42992929
N-[3-(dimethylsulfamoyl)phenyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 42992929) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 42992929 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-4-(2-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccccc1N1CCN(C(=S)Nc2cccc(S(=O)(=O)N(C)C)c2)CC1 |
| InChI | InChI=1S/C20H26N4O3S2/c1-22(2)29(25,26)17-8-6-7-16(15-17)21-20(28)24-13-11-23(12-14-24)18-9-4-5-10-19(18)27-3/h4-10,15H,11-14H2,1-3H3,(H,21,28) |
| InChIKey | UAIQCCUGUCYGCO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|