C21H27N3O3S — CID 3530283
4-(2,4-dimethoxyphenyl)-N-(2-methoxy-5-methylphenyl)piperazine-1-carbothioamide (PubChem CID 3530283) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-(2-methoxy-5-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-(2-methoxy-5-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3530283 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-(2-methoxy-5-methylphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(N2CCN(C(=S)Nc3cc(C)ccc3OC)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-15-5-8-19(26-3)17(13-15)22-21(28)24-11-9-23(10-12-24)18-7-6-16(25-2)14-20(18)27-4/h5-8,13-14H,9-12H2,1-4H3,(H,22,28) |
| InChIKey | IGBFXGALRKUFOI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|