C15H22N2O2S — CID 971545
(2R,6R)-N-(2-methoxy-5-methylphenyl)-2,6-dimethylmorpholine-4-carbothioamide (PubChem CID 971545) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is (2R,6R)-N-(2-methoxy-5-methylphenyl)-2,6-dimethylmorpholine-4-carbothioamide.
| Compound Name | (2R,6R)-N-(2-methoxy-5-methylphenyl)-2,6-dimethylmorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 971545 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2R,6R)-N-(2-methoxy-5-methylphenyl)-2,6-dimethylmorpholine-4-carbothioamide |
| SMILES | COc1ccc(C)cc1NC(=S)N1C[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C15H22N2O2S/c1-10-5-6-14(18-4)13(7-10)16-15(20)17-8-11(2)19-12(3)9-17/h5-7,11-12H,8-9H2,1-4H3,(H,16,20)/t11-,12-/m1/s1 |
| InChIKey | XGGJRYASQMMAEN-VXGBXAGGSA-N |
| XLogP | 2.81 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|