C14H19NOS — CID 2957337
(2,6-dimethylmorpholin-4-yl)-(4-methylphenyl)methanethione (PubChem CID 2957337) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(4-methylphenyl)methanethione.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(4-methylphenyl)methanethione |
|---|---|
| PubChem CID | 2957337 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(4-methylphenyl)methanethione |
| SMILES | Cc1ccc(C(=S)N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C14H19NOS/c1-10-4-6-13(7-5-10)14(17)15-8-11(2)16-12(3)9-15/h4-7,11-12H,8-9H2,1-3H3 |
| InChIKey | DFDNXZXUIMJVLF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|