C13H16FNOS — CID 930357
[(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluorophenyl)methanethione (PubChem CID 930357) has the molecular formula C13H16FNOS and a molecular weight of 253.34 g/mol. Its IUPAC name is [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluorophenyl)methanethione.
| Compound Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluorophenyl)methanethione |
|---|---|
| PubChem CID | 930357 |
| Molecular Formula | C13H16FNOS |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluorophenyl)methanethione |
| SMILES | C[C@H]1CN(C(=S)c2ccc(F)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H16FNOS/c1-9-7-15(8-10(2)16-9)13(17)11-3-5-12(14)6-4-11/h3-6,9-10H,7-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | KCVXPZNTNCURCJ-UWVGGRQHSA-N |
| XLogP | 2.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|