C20H21F2NOS2 — CID 1032637
bis(4-fluorophenyl)methyl (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 1032637) has the molecular formula C20H21F2NOS2 and a molecular weight of 393.52 g/mol. Its IUPAC name is bis(4-fluorophenyl)methyl (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | bis(4-fluorophenyl)methyl (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 1032637 |
| Molecular Formula | C20H21F2NOS2 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | bis(4-fluorophenyl)methyl (2R,6R)-2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | C[C@@H]1CN(C(=S)SC(c2ccc(F)cc2)c2ccc(F)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H21F2NOS2/c1-13-11-23(12-14(2)24-13)20(25)26-19(15-3-7-17(21)8-4-15)16-5-9-18(22)10-6-16/h3-10,13-14,19H,11-12H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | SXXPTJDSWHQGJT-ZIAGYGMSSA-N |
| XLogP | 5.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|