C13H16F2N2OS — CID 2957705
N-(2,4-difluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide (PubChem CID 2957705) has the molecular formula C13H16F2N2OS and a molecular weight of 286.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide.
| Compound Name | N-(2,4-difluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 2957705 |
| Molecular Formula | C13H16F2N2OS |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide |
| SMILES | CC1CN(C(=S)Nc2ccc(F)cc2F)CC(C)O1 |
| InChI | InChI=1S/C13H16F2N2OS/c1-8-6-17(7-9(2)18-8)13(19)16-12-4-3-10(14)5-11(12)15/h3-5,8-9H,6-7H2,1-2H3,(H,16,19) |
| InChIKey | NPDWSOFXZHOTRV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|