C21H25F2N3OS — CID 55639604
1-(2,4-difluorophenyl)-3-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]thiourea (PubChem CID 55639604) has the molecular formula C21H25F2N3OS and a molecular weight of 405.51 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 55639604 |
| Molecular Formula | C21H25F2N3OS |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]thiourea |
| SMILES | CC1CN(Cc2ccc(CNC(=S)Nc3ccc(F)cc3F)cc2)CC(C)O1 |
| InChI | InChI=1S/C21H25F2N3OS/c1-14-11-26(12-15(2)27-14)13-17-5-3-16(4-6-17)10-24-21(28)25-20-8-7-18(22)9-19(20)23/h3-9,14-15H,10-13H2,1-2H3,(H2,24,25,28) |
| InChIKey | WPKIECQDWOLCTK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|