C17H15F3N2S — CID 19654784
N-(2,4-difluorophenyl)-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide (PubChem CID 19654784) has the molecular formula C17H15F3N2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-(2,4-difluorophenyl)-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 19654784 |
| Molecular Formula | C17H15F3N2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide |
| SMILES | CC1CCc2cc(F)ccc2N1C(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F3N2S/c1-10-2-3-11-8-12(18)5-7-16(11)22(10)17(23)21-15-6-4-13(19)9-14(15)20/h4-10H,2-3H2,1H3,(H,21,23) |
| InChIKey | YXNKCUUAXJYYKZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|