C14H17FN2S — CID 17269034
N-cyclopropyl-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide (PubChem CID 17269034) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is N-cyclopropyl-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-cyclopropyl-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 17269034 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-cyclopropyl-6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbothioamide |
| SMILES | CC1CCc2cc(F)ccc2N1C(=S)NC1CC1 |
| InChI | InChI=1S/C14H17FN2S/c1-9-2-3-10-8-11(15)4-7-13(10)17(9)14(18)16-12-5-6-12/h4,7-9,12H,2-3,5-6H2,1H3,(H,16,18) |
| InChIKey | BCMRLPOSHFNQFV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|