C13H16N2S — CID 8619560
(2R)-N-cyclopropyl-2-methyl-2,3-dihydroindole-1-carbothioamide (PubChem CID 8619560) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-methyl-2,3-dihydroindole-1-carbothioamide.
| Compound Name | (2R)-N-cyclopropyl-2-methyl-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 8619560 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (2R)-N-cyclopropyl-2-methyl-2,3-dihydroindole-1-carbothioamide |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=S)NC1CC1 |
| InChI | InChI=1S/C13H16N2S/c1-9-8-10-4-2-3-5-12(10)15(9)13(16)14-11-6-7-11/h2-5,9,11H,6-8H2,1H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | MKNUWAZVFTUICI-SECBINFHSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|