C15H14N2O2S — CID 2374481
N-[(2S)-2-methyl-2,3-dihydroindole-1-carbothioyl]furan-2-carboxamide (PubChem CID 2374481) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-[(2S)-2-methyl-2,3-dihydroindole-1-carbothioyl]furan-2-carboxamide.
| Compound Name | N-[(2S)-2-methyl-2,3-dihydroindole-1-carbothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2374481 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-[(2S)-2-methyl-2,3-dihydroindole-1-carbothioyl]furan-2-carboxamide |
| SMILES | C[C@H]1Cc2ccccc2N1C(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C15H14N2O2S/c1-10-9-11-5-2-3-6-12(11)17(10)15(20)16-14(18)13-7-4-8-19-13/h2-8,10H,9H2,1H3,(H,16,18,20)/t10-/m0/s1 |
| InChIKey | JZDMADFZMXFNLP-JTQLQIEISA-N |
| XLogP | 2.75 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|