C21H23N3O4 — CID 108950845
1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(2-methyl-2,3-dihydroindol-1-yl)propane-1,3-dione (PubChem CID 108950845) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(2-methyl-2,3-dihydroindol-1-yl)propane-1,3-dione.
| Compound Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(2-methyl-2,3-dihydroindol-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108950845 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(2-methyl-2,3-dihydroindol-1-yl)propane-1,3-dione |
| SMILES | CC1Cc2ccccc2N1C(=O)CC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H23N3O4/c1-15-13-16-5-2-3-6-17(16)24(15)20(26)14-19(25)22-8-10-23(11-9-22)21(27)18-7-4-12-28-18/h2-7,12,15H,8-11,13-14H2,1H3 |
| InChIKey | LGHLZLKKCWGFET-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|