C15H16N2S2 — CID 46800236
2-methyl-N-(thiophen-2-ylmethyl)-2,3-dihydroindole-1-carbothioamide (PubChem CID 46800236) has the molecular formula C15H16N2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-methyl-N-(thiophen-2-ylmethyl)-2,3-dihydroindole-1-carbothioamide.
| Compound Name | 2-methyl-N-(thiophen-2-ylmethyl)-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 46800236 |
| Molecular Formula | C15H16N2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-methyl-N-(thiophen-2-ylmethyl)-2,3-dihydroindole-1-carbothioamide |
| SMILES | CC1Cc2ccccc2N1C(=S)NCc1cccs1 |
| InChI | InChI=1S/C15H16N2S2/c1-11-9-12-5-2-3-7-14(12)17(11)15(18)16-10-13-6-4-8-19-13/h2-8,11H,9-10H2,1H3,(H,16,18) |
| InChIKey | CJYPKOHOSBZSQQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|