C16H20N4S — CID 40576503
(2R)-2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydroindole-1-carbothioamide (PubChem CID 40576503) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is (2R)-2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydroindole-1-carbothioamide.
| Compound Name | (2R)-2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 40576503 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2R)-2-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydroindole-1-carbothioamide |
| SMILES | Cc1nn(C)c(C)c1NC(=S)N1c2ccccc2C[C@H]1C |
| InChI | InChI=1S/C16H20N4S/c1-10-9-13-7-5-6-8-14(13)20(10)16(21)17-15-11(2)18-19(4)12(15)3/h5-8,10H,9H2,1-4H3,(H,17,21)/t10-/m1/s1 |
| InChIKey | NTAQAHDWOOFJCQ-SNVBAGLBSA-N |
| XLogP | 3.18 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|