C22H18N4S — CID 126326019
(2S)-2-methyl-N-(1,10-phenanthrolin-5-yl)-2,3-dihydroindole-1-carbothioamide (PubChem CID 126326019) has the molecular formula C22H18N4S and a molecular weight of 370.48 g/mol. Its IUPAC name is (2S)-2-methyl-N-(1,10-phenanthrolin-5-yl)-2,3-dihydroindole-1-carbothioamide.
| Compound Name | (2S)-2-methyl-N-(1,10-phenanthrolin-5-yl)-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 126326019 |
| Molecular Formula | C22H18N4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (2S)-2-methyl-N-(1,10-phenanthrolin-5-yl)-2,3-dihydroindole-1-carbothioamide |
| SMILES | C[C@H]1Cc2ccccc2N1C(=S)Nc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C22H18N4S/c1-14-12-15-6-2-3-9-19(15)26(14)22(27)25-18-13-16-7-4-10-23-20(16)21-17(18)8-5-11-24-21/h2-11,13-14H,12H2,1H3,(H,25,27)/t14-/m0/s1 |
| InChIKey | NAPZMHDKNCEHRD-AWEZNQCLSA-N |
| XLogP | 4.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|