C21H19N5S — CID 3328210
1-[4-(dimethylamino)phenyl]-3-(1,10-phenanthrolin-5-yl)thiourea (PubChem CID 3328210) has the molecular formula C21H19N5S and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-(1,10-phenanthrolin-5-yl)thiourea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-(1,10-phenanthrolin-5-yl)thiourea |
|---|---|
| PubChem CID | 3328210 |
| Molecular Formula | C21H19N5S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-(1,10-phenanthrolin-5-yl)thiourea |
| SMILES | CN(C)c1ccc(NC(=S)Nc2cc3cccnc3c3ncccc23)cc1 |
| InChI | InChI=1S/C21H19N5S/c1-26(2)16-9-7-15(8-10-16)24-21(27)25-18-13-14-5-3-11-22-19(14)20-17(18)6-4-12-23-20/h3-13H,1-2H3,(H2,24,25,27) |
| InChIKey | PREAIJBPLHHGJJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|