C16H16N4S — CID 3983344
1-(1,7-phenanthrolin-6-yl)-3-propan-2-ylthiourea (PubChem CID 3983344) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-(1,7-phenanthrolin-6-yl)-3-propan-2-ylthiourea.
| Compound Name | 1-(1,7-phenanthrolin-6-yl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 3983344 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-(1,7-phenanthrolin-6-yl)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1cc2cccnc2c2cccnc12 |
| InChI | InChI=1S/C16H16N4S/c1-10(2)19-16(21)20-13-9-11-5-3-7-17-14(11)12-6-4-8-18-15(12)13/h3-10H,1-2H3,(H2,19,20,21) |
| InChIKey | IHKSAQDFLGOHEU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|