C19H22N4O — CID 3432209
3-(1,7-phenanthrolin-6-yl)-1,1-di(propan-2-yl)urea (PubChem CID 3432209) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-(1,7-phenanthrolin-6-yl)-1,1-di(propan-2-yl)urea.
| Compound Name | 3-(1,7-phenanthrolin-6-yl)-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 3432209 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-(1,7-phenanthrolin-6-yl)-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)Nc1cc2cccnc2c2cccnc12)C(C)C |
| InChI | InChI=1S/C19H22N4O/c1-12(2)23(13(3)4)19(24)22-16-11-14-7-5-9-20-17(14)15-8-6-10-21-18(15)16/h5-13H,1-4H3,(H,22,24) |
| InChIKey | UWNQLQHBKIYLNA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|