C19H21N3O3 — CID 144761202
ethane;5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoic acid (PubChem CID 144761202) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethane;5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoic acid.
| Compound Name | ethane;5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 144761202 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethane;5-oxo-5-(1,10-phenanthrolin-5-ylamino)pentanoic acid |
| SMILES | CC.O=C(O)CCCC(=O)Nc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C17H15N3O3.C2H6/c21-14(6-1-7-15(22)23)20-13-10-11-4-2-8-18-16(11)17-12(13)5-3-9-19-17;1-2/h2-5,8-10H,1,6-7H2,(H,20,21)(H,22,23);1-2H3 |
| InChIKey | KDDKMOHBLUOUNJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|