C23H27N3O3 — CID 68545365
methyl 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoate (PubChem CID 68545365) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is methyl 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoate.
| Compound Name | methyl 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoate |
|---|---|
| PubChem CID | 68545365 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | methyl 10-oxo-10-(1,10-phenanthrolin-5-ylamino)decanoate |
| SMILES | COC(=O)CCCCCCCCC(=O)Nc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C23H27N3O3/c1-29-21(28)13-7-5-3-2-4-6-12-20(27)26-19-16-17-10-8-14-24-22(17)23-18(19)11-9-15-25-23/h8-11,14-16H,2-7,12-13H2,1H3,(H,26,27) |
| InChIKey | POVSOPYEATYZDN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|