C34H35N9O3 — CID 162227256
4-amino-N-(1,10-phenanthrolin-5-yl)butanamide;4-N-(3-aminopropyl)-7-N-methyl-1,10-phenanthroline-4,7-dicarboxamide (PubChem CID 162227256) has the molecular formula C34H35N9O3 and a molecular weight of 617.71 g/mol. Its IUPAC name is 4-amino-N-(1,10-phenanthrolin-5-yl)butanamide;4-N-(3-aminopropyl)-7-N-methyl-1,10-phenanthroline-4,7-dicarboxamide.
| Compound Name | 4-amino-N-(1,10-phenanthrolin-5-yl)butanamide;4-N-(3-aminopropyl)-7-N-methyl-1,10-phenanthroline-4,7-dicarboxamide |
|---|---|
| PubChem CID | 162227256 |
| Molecular Formula | C34H35N9O3 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 4-amino-N-(1,10-phenanthrolin-5-yl)butanamide;4-N-(3-aminopropyl)-7-N-methyl-1,10-phenanthroline-4,7-dicarboxamide |
| SMILES | CNC(=O)c1ccnc2c1ccc1c(C(=O)NCCCN)ccnc12.NCCCC(=O)Nc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C18H19N5O2.C16H16N4O/c1-20-17(24)13-5-9-21-15-11(13)3-4-12-14(6-10-22-16(12)15)18(25)23-8-2-7-19;17-7-1-6-14(21)20-13-10-11-4-2-8-18-15(11)16-12(13)5-3-9-19-16/h3-6,9-10H,2,7-8,19H2,1H3,(H,20,24)(H,23,25);2-5,8-10H,1,6-7,17H2,(H,20,21) |
| InChIKey | ZUXQIUBWZDFEHF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 190.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|