C22H27N3O — CID 144610995
3-ethyl-3-methyl-N-(1,10-phenanthrolin-5-yl)heptanamide (PubChem CID 144610995) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 3-ethyl-3-methyl-N-(1,10-phenanthrolin-5-yl)heptanamide.
| Compound Name | 3-ethyl-3-methyl-N-(1,10-phenanthrolin-5-yl)heptanamide |
|---|---|
| PubChem CID | 144610995 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 3-ethyl-3-methyl-N-(1,10-phenanthrolin-5-yl)heptanamide |
| SMILES | CCCCC(C)(CC)CC(=O)Nc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C22H27N3O/c1-4-6-11-22(3,5-2)15-19(26)25-18-14-16-9-7-12-23-20(16)21-17(18)10-8-13-24-21/h7-10,12-14H,4-6,11,15H2,1-3H3,(H,25,26) |
| InChIKey | OWSWMKSQAKGJID-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|