C32H39N3O4 — CID 143232858
6-(4,4-diethyl-2,6-dioxocyclohexylidene)-6-hydroxy-3,3,5,5-tetramethyl-N-(1,10-phenanthrolin-5-yl)hexanamide (PubChem CID 143232858) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is 6-(4,4-diethyl-2,6-dioxocyclohexylidene)-6-hydroxy-3,3,5,5-tetramethyl-N-(1,10-phenanthrolin-5-yl)hexanamide.
| Compound Name | 6-(4,4-diethyl-2,6-dioxocyclohexylidene)-6-hydroxy-3,3,5,5-tetramethyl-N-(1,10-phenanthrolin-5-yl)hexanamide |
|---|---|
| PubChem CID | 143232858 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 6-(4,4-diethyl-2,6-dioxocyclohexylidene)-6-hydroxy-3,3,5,5-tetramethyl-N-(1,10-phenanthrolin-5-yl)hexanamide |
| SMILES | CCC1(CC)CC(=O)C(=C(O)C(C)(C)CC(C)(C)CC(=O)Nc2cc3cccnc3c3ncccc23)C(=O)C1 |
| InChI | InChI=1S/C32H39N3O4/c1-7-32(8-2)16-23(36)26(24(37)17-32)29(39)31(5,6)19-30(3,4)18-25(38)35-22-15-20-11-9-13-33-27(20)28-21(22)12-10-14-34-28/h9-15,39H,7-8,16-19H2,1-6H3,(H,35,38) |
| InChIKey | BIEUDHSBKQQWDX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|