C23H26N4O — CID 5024265
1,3,3-trimethyl-N-(1,10-phenanthrolin-5-yl)-6-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 5024265) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 1,3,3-trimethyl-N-(1,10-phenanthrolin-5-yl)-6-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | 1,3,3-trimethyl-N-(1,10-phenanthrolin-5-yl)-6-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 5024265 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 1,3,3-trimethyl-N-(1,10-phenanthrolin-5-yl)-6-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)Nc2cc3cccnc3c3ncccc23)C1 |
| InChI | InChI=1S/C23H26N4O/c1-22(2)11-16-12-23(3,13-22)14-27(16)21(28)26-18-10-15-6-4-8-24-19(15)20-17(18)7-5-9-25-20/h4-10,16H,11-14H2,1-3H3,(H,26,28) |
| InChIKey | CSZQGCIVFHHCNM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|